C23H33F3N4O2 — CID 44536494
1-hexyl-N-[(3-imidazol-1-ylphenyl)methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 44536494) has the molecular formula C23H33F3N4O2 and a molecular weight of 454.54 g/mol. Its IUPAC name is 1-hexyl-N-[(3-imidazol-1-ylphenyl)methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-hexyl-N-[(3-imidazol-1-ylphenyl)methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44536494 |
| Molecular Formula | C23H33F3N4O2 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 1-hexyl-N-[(3-imidazol-1-ylphenyl)methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCN1CCC(NCc2cccc(-n3ccnc3)c2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H32N4.C2HF3O2/c1-2-3-4-5-12-24-13-9-20(10-14-24)23-17-19-7-6-8-21(16-19)25-15-11-22-18-25;3-2(4,5)1(6)7/h6-8,11,15-16,18,20,23H,2-5,9-10,12-14,17H2,1H3;(H,6,7) |
| InChIKey | TZPLYOSVXJMNMR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|