C32H36F3N5O5S — CID 44536563
N-[[2-[4-(butylaminomethyl)phenyl]-1,3-thiazol-4-yl]methyl]-N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 44536563) has the molecular formula C32H36F3N5O5S and a molecular weight of 659.73 g/mol. Its IUPAC name is N-[[2-[4-(butylaminomethyl)phenyl]-1,3-thiazol-4-yl]methyl]-N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[2-[4-(butylaminomethyl)phenyl]-1,3-thiazol-4-yl]methyl]-N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44536563 |
| Molecular Formula | C32H36F3N5O5S |
| Molecular Weight | 659.73 g/mol |
| Exact Mass | 659.24 |
| IUPAC Name | N-[[2-[4-(butylaminomethyl)phenyl]-1,3-thiazol-4-yl]methyl]-N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNCc1ccc(-c2nc(CN(CCCn3ccnc3)C(=O)C3COc4ccccc4O3)cs2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H35N5O3S.C2HF3O2/c1-2-3-13-31-18-23-9-11-24(12-10-23)29-33-25(21-39-29)19-35(16-6-15-34-17-14-32-22-34)30(36)28-20-37-26-7-4-5-8-27(26)38-28;3-2(4,5)1(6)7/h4-5,7-12,14,17,21-22,28,31H,2-3,6,13,15-16,18-20H2,1H3;(H,6,7) |
| InChIKey | KWYPWTCLYMJOQU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.73 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|