C29H32Cl2N4O2S2 — CID 44536659
1-[1-(3,4-dichlorophenyl)-3-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)propyl]-3-phenylthiourea (PubChem CID 44536659) has the molecular formula C29H32Cl2N4O2S2 and a molecular weight of 603.64 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)-3-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)propyl]-3-phenylthiourea.
| Compound Name | 1-[1-(3,4-dichlorophenyl)-3-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)propyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 44536659 |
| Molecular Formula | C29H32Cl2N4O2S2 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)-3-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)propyl]-3-phenylthiourea |
| SMILES | CS(=O)(=O)N1CC2(CCN(CCC(NC(=S)Nc3ccccc3)c3ccc(Cl)c(Cl)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C29H32Cl2N4O2S2/c1-39(36,37)35-20-29(23-9-5-6-10-27(23)35)14-17-34(18-15-29)16-13-26(21-11-12-24(30)25(31)19-21)33-28(38)32-22-7-3-2-4-8-22/h2-12,19,26H,13-18,20H2,1H3,(H2,32,33,38) |
| InChIKey | AVGGLWCCZIZIFS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|