C33H29F6N5O4 — CID 44536680
8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-2-[[2-hydroxy-3-(2-phenylethylamino)propyl]amino]pyrido[2,3-d]pyrimidin-7-one;2,2,2-trifluoroacetic acid (PubChem CID 44536680) has the molecular formula C33H29F6N5O4 and a molecular weight of 673.61 g/mol. Its IUPAC name is 8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-2-[[2-hydroxy-3-(2-phenylethylamino)propyl]amino]pyrido[2,3-d]pyrimidin-7-one;2,2,2-trifluoroacetic acid.
| Compound Name | 8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-2-[[2-hydroxy-3-(2-phenylethylamino)propyl]amino]pyrido[2,3-d]pyrimidin-7-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44536680 |
| Molecular Formula | C33H29F6N5O4 |
| Molecular Weight | 673.61 g/mol |
| Exact Mass | 673.21 |
| IUPAC Name | 8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-2-[[2-hydroxy-3-(2-phenylethylamino)propyl]amino]pyrido[2,3-d]pyrimidin-7-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(F)ccc1-c1nc(NCC(O)CNCCc2ccccc2)nc2c1ccc(=O)n2-c1c(F)cccc1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H28F3N5O2.C2HF3O2/c1-19-16-21(32)10-11-23(19)28-24-12-13-27(41)39(29-25(33)8-5-9-26(29)34)30(24)38-31(37-28)36-18-22(40)17-35-15-14-20-6-3-2-4-7-20;3-2(4,5)1(6)7/h2-13,16,22,35,40H,14-15,17-18H2,1H3,(H,36,37,38);(H,6,7) |
| InChIKey | QKDWHGMBNQUNCV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|