C25H23F6N3O4 — CID 44536907
1-[4-[2-(benzylamino)ethyl]phenyl]-3-[4-(trifluoromethoxy)phenyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 44536907) has the molecular formula C25H23F6N3O4 and a molecular weight of 543.46 g/mol. Its IUPAC name is 1-[4-[2-(benzylamino)ethyl]phenyl]-3-[4-(trifluoromethoxy)phenyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[4-[2-(benzylamino)ethyl]phenyl]-3-[4-(trifluoromethoxy)phenyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44536907 |
| Molecular Formula | C25H23F6N3O4 |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 1-[4-[2-(benzylamino)ethyl]phenyl]-3-[4-(trifluoromethoxy)phenyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccc(CCNCc2ccccc2)cc1)Nc1ccc(OC(F)(F)F)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H22F3N3O2.C2HF3O2/c24-23(25,26)31-21-12-10-20(11-13-21)29-22(30)28-19-8-6-17(7-9-19)14-15-27-16-18-4-2-1-3-5-18;3-2(4,5)1(6)7/h1-13,27H,14-16H2,(H2,28,29,30);(H,6,7) |
| InChIKey | FLOAEXVEDKJNPJ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|