C22H29Cl5N2O2 — CID 44537011
1-(3,4-dichlorophenyl)-2-[6-[[2-(3,4-dichlorophenyl)-2-hydroxyethyl]amino]hexylamino]ethanol;hydrochloride (PubChem CID 44537011) has the molecular formula C22H29Cl5N2O2 and a molecular weight of 530.75 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-[6-[[2-(3,4-dichlorophenyl)-2-hydroxyethyl]amino]hexylamino]ethanol;hydrochloride.
| Compound Name | 1-(3,4-dichlorophenyl)-2-[6-[[2-(3,4-dichlorophenyl)-2-hydroxyethyl]amino]hexylamino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 44537011 |
| Molecular Formula | C22H29Cl5N2O2 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-[6-[[2-(3,4-dichlorophenyl)-2-hydroxyethyl]amino]hexylamino]ethanol;hydrochloride |
| SMILES | Cl.OC(CNCCCCCCNCC(O)c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H28Cl4N2O2.ClH/c23-17-7-5-15(11-19(17)25)21(29)13-27-9-3-1-2-4-10-28-14-22(30)16-6-8-18(24)20(26)12-16;/h5-8,11-12,21-22,27-30H,1-4,9-10,13-14H2;1H |
| InChIKey | DCLQPSCMFPWYGW-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|