C21H15N3O2 — CID 44537045
5-methoxy-13-phenyl-12,13,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,10,15-heptaen-14-one (PubChem CID 44537045) has the molecular formula C21H15N3O2 and a molecular weight of 341.37 g/mol. Its IUPAC name is 5-methoxy-13-phenyl-12,13,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,10,15-heptaen-14-one.
| Compound Name | 5-methoxy-13-phenyl-12,13,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,10,15-heptaen-14-one |
|---|---|
| PubChem CID | 44537045 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 5-methoxy-13-phenyl-12,13,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,10,15-heptaen-14-one |
| SMILES | COc1ccc2c(ccc3c2ncc2c(=O)n(-c4ccccc4)[nH]c23)c1 |
| InChI | InChI=1S/C21H15N3O2/c1-26-15-8-10-16-13(11-15)7-9-17-19(16)22-12-18-20(17)23-24(21(18)25)14-5-3-2-4-6-14/h2-12,23H,1H3 |
| InChIKey | QWVXYTFGAMCFRE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|