About 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride
2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride (PubChem CID 44537251) has the molecular formula C24H31ClN2O
and a molecular weight of 398.98 g/mol. Its IUPAC name is 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride |
| PubChem CID | 44537251 |
| Molecular Formula | C24H31ClN2O |
| Molecular Weight | 398.98 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride |
| SMILES | CCN(CC)CC(O)c1cc(-c2ccc(C)cc2)nc2c(C)cc(C)cc12.Cl |
| InChI | InChI=1S/C24H30N2O.ClH/c1-6-26(7-2)15-23(27)20-14-22(19-10-8-16(3)9-11-19)25-24-18(5)12-17(4)13-21(20)24;/h8-14,23,27H,6-7,15H2,1-5H3;1H |
| InChIKey | XTYKQZPACCXSRY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.98 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride?
The IUPAC name of 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride (CID 44537251) is 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride.
What is the SMILES notation for 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride?
The canonical SMILES for 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride is CCN(CC)CC(O)c1cc(-c2ccc(C)cc2)nc2c(C)cc(C)cc12.Cl.
What is the InChIKey of 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride?
The InChIKey is XTYKQZPACCXSRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O.ClH/c1-6-26(7-2)15-23(27)20-14-22(19-10-8-16(3)9-11-19)25-24-18(5)12-17(4)13-21(20)24;/h8-14,23,27H,6-7,15H2,1-5H3;1H.
What are the key properties of 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride?
2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride has a molecular weight of 398.98 g/mol, XLogP of 5.62, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-1-[6,8-dimethyl-2-(4-methylphenyl)quinolin-4-yl]ethanol;hydrochloride is sourced from PubChem (CID 44537251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).