About 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride
5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride (PubChem CID 44537276) has the molecular formula C23H32ClNO2
and a molecular weight of 389.97 g/mol. Its IUPAC name is 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride.
Molecular Properties
| Compound Name | 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride |
| PubChem CID | 44537276 |
| Molecular Formula | C23H32ClNO2 |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)c1ccncc1-2.Cl |
| InChI | InChI=1S/C23H31NO2.ClH/c1-6-7-8-9-11-22(2,3)16-13-19(25)21-17-15-24-12-10-18(17)23(4,5)26-20(21)14-16;/h10,12-15,25H,6-9,11H2,1-5H3;1H |
| InChIKey | QMWQEYZMCQXNMV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride?
The IUPAC name of 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride (CID 44537276) is 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride.
What is the SMILES notation for 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride?
The canonical SMILES for 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride is CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)c1ccncc1-2.Cl.
What is the InChIKey of 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride?
The InChIKey is QMWQEYZMCQXNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO2.ClH/c1-6-7-8-9-11-22(2,3)16-13-19(25)21-17-15-24-12-10-18(17)23(4,5)26-20(21)14-16;/h10,12-15,25H,6-9,11H2,1-5H3;1H.
What are the key properties of 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride?
5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride has a molecular weight of 389.97 g/mol, XLogP of 6.75, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-8-(2-methyloctan-2-yl)chromeno[4,3-c]pyridin-10-ol;hydrochloride is sourced from PubChem (CID 44537276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).