C24H30BrN3 — CID 44537288
4-N-[3-(4-bromophenyl)quinolin-4-yl]-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 44537288) has the molecular formula C24H30BrN3 and a molecular weight of 440.43 g/mol. Its IUPAC name is 4-N-[3-(4-bromophenyl)quinolin-4-yl]-1-N,1-N-diethylpentane-1,4-diamine.
| Compound Name | 4-N-[3-(4-bromophenyl)quinolin-4-yl]-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 44537288 |
| Molecular Formula | C24H30BrN3 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-N-[3-(4-bromophenyl)quinolin-4-yl]-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1c(-c2ccc(Br)cc2)cnc2ccccc12 |
| InChI | InChI=1S/C24H30BrN3/c1-4-28(5-2)16-8-9-18(3)27-24-21-10-6-7-11-23(21)26-17-22(24)19-12-14-20(25)15-13-19/h6-7,10-15,17-18H,4-5,8-9,16H2,1-3H3,(H,26,27) |
| InChIKey | UJFNYFYGEZKWLN-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |