C19H17ClN2O — CID 44537308
7-(4-chlorophenoxy)-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 44537308) has the molecular formula C19H17ClN2O and a molecular weight of 324.81 g/mol. Its IUPAC name is 7-(4-chlorophenoxy)-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 7-(4-chlorophenoxy)-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 44537308 |
| Molecular Formula | C19H17ClN2O |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 7-(4-chlorophenoxy)-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | Nc1c2c(nc3ccc(Oc4ccc(Cl)cc4)cc13)CCCC2 |
| InChI | InChI=1S/C19H17ClN2O/c20-12-5-7-13(8-6-12)23-14-9-10-18-16(11-14)19(21)15-3-1-2-4-17(15)22-18/h5-11H,1-4H2,(H2,21,22) |
| InChIKey | APFRPSBWVSEADR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |