C31H37N3O6 — CID 44537347
(Z)-but-2-enedioic acid;4-phenylmethoxy-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]pyridin-2-amine (PubChem CID 44537347) has the molecular formula C31H37N3O6 and a molecular weight of 547.65 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;4-phenylmethoxy-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]pyridin-2-amine.
| Compound Name | (Z)-but-2-enedioic acid;4-phenylmethoxy-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 44537347 |
| Molecular Formula | C31H37N3O6 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | (Z)-but-2-enedioic acid;4-phenylmethoxy-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]pyridin-2-amine |
| SMILES | O=C(O)/C=C\C(=O)O.c1ccc(COc2ccnc(NCCCOc3cccc(CN4CCCCC4)c3)c2)cc1 |
| InChI | InChI=1S/C27H33N3O2.C4H4O4/c1-3-9-23(10-4-1)22-32-26-13-15-29-27(20-26)28-14-8-18-31-25-12-7-11-24(19-25)21-30-16-5-2-6-17-30;5-3(6)1-2-4(7)8/h1,3-4,7,9-13,15,19-20H,2,5-6,8,14,16-18,21-22H2,(H,28,29);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | SXFUIEDQUDXTKR-BTJKTKAUSA-N |
| XLogP | 5.24 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|