C19H28O4 — CID 44537411
(1R,2S,3aR,12E,13aS)-1,3a-dihydroxy-2,5,8,8-tetramethyl-2,3,7,10,11,13a-hexahydro-1H-cyclopenta[12]annulene-4,9-dione (PubChem CID 44537411) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (1R,2S,3aR,12E,13aS)-1,3a-dihydroxy-2,5,8,8-tetramethyl-2,3,7,10,11,13a-hexahydro-1H-cyclopenta[12]annulene-4,9-dione.
| Compound Name | (1R,2S,3aR,12E,13aS)-1,3a-dihydroxy-2,5,8,8-tetramethyl-2,3,7,10,11,13a-hexahydro-1H-cyclopenta[12]annulene-4,9-dione |
|---|---|
| PubChem CID | 44537411 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (1R,2S,3aR,12E,13aS)-1,3a-dihydroxy-2,5,8,8-tetramethyl-2,3,7,10,11,13a-hexahydro-1H-cyclopenta[12]annulene-4,9-dione |
| SMILES | CC1=CCC(C)(C)C(=O)CC/C=C/[C@H]2[C@H](O)[C@@H](C)C[C@]2(O)C1=O |
| InChI | InChI=1S/C19H28O4/c1-12-9-10-18(3,4)15(20)8-6-5-7-14-16(21)13(2)11-19(14,23)17(12)22/h5,7,9,13-14,16,21,23H,6,8,10-11H2,1-4H3/b7-5+,12-9?/t13-,14-,16+,19+/m0/s1 |
| InChIKey | YKMYUCYSFUZKHG-SDXFPLFLSA-N |
| XLogP | 2.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|