C11H11FN2O — CID 44537689
8-fluoro-1,2,3,9-tetrahydropyrrolo[2,1-b]quinazolin-9-ol (PubChem CID 44537689) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is 8-fluoro-1,2,3,9-tetrahydropyrrolo[2,1-b]quinazolin-9-ol.
| Compound Name | 8-fluoro-1,2,3,9-tetrahydropyrrolo[2,1-b]quinazolin-9-ol |
|---|---|
| PubChem CID | 44537689 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 8-fluoro-1,2,3,9-tetrahydropyrrolo[2,1-b]quinazolin-9-ol |
| SMILES | OC1c2c(F)cccc2N=C2CCCN21 |
| InChI | InChI=1S/C11H11FN2O/c12-7-3-1-4-8-10(7)11(15)14-6-2-5-9(14)13-8/h1,3-4,11,15H,2,5-6H2 |
| InChIKey | TZNNDTQWUMANTB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |