C15H19N3O6 — CID 44537937
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(4-(111C)methoxyphenyl)triazol-1-yl]oxane-3,4,5-triol (PubChem CID 44537937) has the molecular formula C15H19N3O6 and a molecular weight of 336.33 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(4-(111C)methoxyphenyl)triazol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(4-(111C)methoxyphenyl)triazol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 44537937 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(4-(111C)methoxyphenyl)triazol-1-yl]oxane-3,4,5-triol |
| SMILES | [11CH3]Oc1ccc(-c2cn([C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)nn2)cc1 |
| InChI | InChI=1S/C15H19N3O6/c1-23-9-4-2-8(3-5-9)10-6-18(17-16-10)15-14(22)13(21)12(20)11(7-19)24-15/h2-6,11-15,19-22H,7H2,1H3/t11-,12+,13+,14-,15-/m1/s1/i1-1 |
| InChIKey | BDGJXKOMXNXPDQ-MSXURBHGSA-N |
| XLogP | -1.07 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |