C21H25ClFN3O3 — CID 44537976
3-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-1,1-di(propan-2-yl)urea (PubChem CID 44537976) has the molecular formula C21H25ClFN3O3 and a molecular weight of 421.90 g/mol. Its IUPAC name is 3-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-1,1-di(propan-2-yl)urea.
| Compound Name | 3-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-1,1-di(propan-2-yl)urea |
|---|---|
| PubChem CID | 44537976 |
| Molecular Formula | C21H25ClFN3O3 |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]-1,1-di(propan-2-yl)urea |
| SMILES | CC(C)N(C(=O)Nc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl)C(C)C |
| InChI | InChI=1S/C21H25ClFN3O3/c1-11(2)25(12(3)4)21(29)24-17-10-18(16(23)9-15(17)22)26-19(27)13-7-5-6-8-14(13)20(26)28/h9-12H,5-8H2,1-4H3,(H,24,29) |
| InChIKey | FVOZYOFOTVBWAW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|