C31H29F6N3O5 — CID 44538128
3-[[3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-[(E)-prop-1-enyl]-2-pyridinyl]oxy]phenyl]methyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione (PubChem CID 44538128) has the molecular formula C31H29F6N3O5 and a molecular weight of 637.58 g/mol. Its IUPAC name is 3-[[3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-[(E)-prop-1-enyl]-2-pyridinyl]oxy]phenyl]methyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-[(E)-prop-1-enyl]-2-pyridinyl]oxy]phenyl]methyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 44538128 |
| Molecular Formula | C31H29F6N3O5 |
| Molecular Weight | 637.58 g/mol |
| Exact Mass | 637.20 |
| IUPAC Name | 3-[[3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-[(E)-prop-1-enyl]-2-pyridinyl]oxy]phenyl]methyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
| SMILES | C/C=C/c1cc(C(O)(C(F)(F)F)C(F)(F)F)cnc1Oc1cccc(CN2C(=O)NC(C)(c3ccc(OC(C)C)cc3)C2=O)c1 |
| InChI | InChI=1S/C31H29F6N3O5/c1-5-7-20-15-22(29(43,30(32,33)34)31(35,36)37)16-38-25(20)45-24-9-6-8-19(14-24)17-40-26(41)28(4,39-27(40)42)21-10-12-23(13-11-21)44-18(2)3/h5-16,18,43H,17H2,1-4H3,(H,39,42)/b7-5+ |
| InChIKey | IPNKMFBGOYTAHY-FNORWQNLSA-N |
| XLogP | 6.97 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.58 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|