C35H31F6N3O5 — CID 44538239
3-[[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]methyl]-5-methyl-5-(6-phenylmethoxy-3-pyridinyl)imidazolidine-2,4-dione (PubChem CID 44538239) has the molecular formula C35H31F6N3O5 and a molecular weight of 687.64 g/mol. Its IUPAC name is 3-[[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]methyl]-5-methyl-5-(6-phenylmethoxy-3-pyridinyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]methyl]-5-methyl-5-(6-phenylmethoxy-3-pyridinyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 44538239 |
| Molecular Formula | C35H31F6N3O5 |
| Molecular Weight | 687.64 g/mol |
| Exact Mass | 687.22 |
| IUPAC Name | 3-[[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]methyl]-5-methyl-5-(6-phenylmethoxy-3-pyridinyl)imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1cccc(CN2C(=O)NC(C)(c3ccc(OCc4ccccc4)nc3)C2=O)c1 |
| InChI | InChI=1S/C35H31F6N3O5/c1-3-8-24-18-25(33(47,34(36,37)38)35(39,40)41)13-15-28(24)49-27-12-7-11-23(17-27)20-44-30(45)32(2,43-31(44)46)26-14-16-29(42-19-26)48-21-22-9-5-4-6-10-22/h4-7,9-19,47H,3,8,20-21H2,1-2H3,(H,43,46) |
| InChIKey | ATHOSKUSQVICDA-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.64 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|