C34H37F6N3O4 — CID 44538342
3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]-2-pyridinyl]methyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione (PubChem CID 44538342) has the molecular formula C34H37F6N3O4 and a molecular weight of 665.68 g/mol. Its IUPAC name is 3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]-2-pyridinyl]methyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]-2-pyridinyl]methyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 44538342 |
| Molecular Formula | C34H37F6N3O4 |
| Molecular Weight | 665.68 g/mol |
| Exact Mass | 665.27 |
| IUPAC Name | 3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]-2-pyridinyl]methyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1Oc1ccnc(CN2C(=O)NC(C)(c3ccc(C(C)C)cc3)C2=O)c1 |
| InChI | InChI=1S/C34H37F6N3O4/c1-6-8-22-16-25(32(46,33(35,36)37)34(38,39)40)17-23(9-7-2)28(22)47-27-14-15-41-26(18-27)19-43-29(44)31(5,42-30(43)45)24-12-10-21(11-13-24)20(3)4/h10-18,20,46H,6-9,19H2,1-5H3,(H,42,45) |
| InChIKey | OWVPJIOKDJHFTI-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.68 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|