C32H31F6N3O5 — CID 44538343
5-(2,2-dimethyl-3H-1-benzofuran-6-yl)-3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 44538343) has the molecular formula C32H31F6N3O5 and a molecular weight of 651.60 g/mol. Its IUPAC name is 5-(2,2-dimethyl-3H-1-benzofuran-6-yl)-3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,2-dimethyl-3H-1-benzofuran-6-yl)-3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 44538343 |
| Molecular Formula | C32H31F6N3O5 |
| Molecular Weight | 651.60 g/mol |
| Exact Mass | 651.22 |
| IUPAC Name | 5-(2,2-dimethyl-3H-1-benzofuran-6-yl)-3-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1ccnc(CN2C(=O)NC(C)(c3ccc4c(c3)OC(C)(C)C4)C2=O)c1 |
| InChI | InChI=1S/C32H31F6N3O5/c1-5-6-18-13-21(30(44,31(33,34)35)32(36,37)38)9-10-24(18)45-23-11-12-39-22(15-23)17-41-26(42)29(4,40-27(41)43)20-8-7-19-16-28(2,3)46-25(19)14-20/h7-15,44H,5-6,16-17H2,1-4H3,(H,40,43) |
| InChIKey | OBVCHHSNAKMPCT-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.60 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|