C21H19FN4O4 — CID 44538622
1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(4-fluorophenyl)urea (PubChem CID 44538622) has the molecular formula C21H19FN4O4 and a molecular weight of 410.41 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 44538622 |
| Molecular Formula | C21H19FN4O4 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(4-fluorophenyl)urea |
| SMILES | O=C1CCC(N2Cc3cc(CNC(=O)Nc4ccc(F)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H19FN4O4/c22-14-2-4-15(5-3-14)24-21(30)23-10-12-1-6-16-13(9-12)11-26(20(16)29)17-7-8-18(27)25-19(17)28/h1-6,9,17H,7-8,10-11H2,(H2,23,24,30)(H,25,27,28) |
| InChIKey | UOIFABFUVWVKFZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|