C22H16N4O2 — CID 44538803
3-(furan-3-yl)-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-8-amine (PubChem CID 44538803) has the molecular formula C22H16N4O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 3-(furan-3-yl)-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 3-(furan-3-yl)-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 44538803 |
| Molecular Formula | C22H16N4O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-(furan-3-yl)-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-8-amine |
| SMILES | Nc1nccn2c(-c3ccoc3)nc(-c3ccc(Oc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C22H16N4O2/c23-21-20-19(25-22(16-10-13-27-14-16)26(20)12-11-24-21)15-6-8-18(9-7-15)28-17-4-2-1-3-5-17/h1-14H,(H2,23,24) |
| InChIKey | TUGZHCPNPTWOOK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |