C21H19N5O — CID 44539287
7-cyclobutyl-5-(4-phenoxyphenyl)imidazo[5,1-f][1,2,4]triazin-4-amine (PubChem CID 44539287) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 7-cyclobutyl-5-(4-phenoxyphenyl)imidazo[5,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-cyclobutyl-5-(4-phenoxyphenyl)imidazo[5,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 44539287 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 7-cyclobutyl-5-(4-phenoxyphenyl)imidazo[5,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c(C3CCC3)nc(-c3ccc(Oc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C21H19N5O/c22-20-19-18(25-21(15-5-4-6-15)26(19)24-13-23-20)14-9-11-17(12-10-14)27-16-7-2-1-3-8-16/h1-3,7-13,15H,4-6H2,(H2,22,23,24) |
| InChIKey | BXZICJTYDLVXEI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |