C15H14N2O4 — CID 44539329
10-hydroxy-4-(hydroxymethyl)-1,6-dimethyl-9H-pyrido[3,2-g]quinoline-2,8-dione (PubChem CID 44539329) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 10-hydroxy-4-(hydroxymethyl)-1,6-dimethyl-9H-pyrido[3,2-g]quinoline-2,8-dione.
| Compound Name | 10-hydroxy-4-(hydroxymethyl)-1,6-dimethyl-9H-pyrido[3,2-g]quinoline-2,8-dione |
|---|---|
| PubChem CID | 44539329 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 10-hydroxy-4-(hydroxymethyl)-1,6-dimethyl-9H-pyrido[3,2-g]quinoline-2,8-dione |
| SMILES | Cc1cc(=O)[nH]c2c(O)c3c(cc12)c(CO)cc(=O)n3C |
| InChI | InChI=1S/C15H14N2O4/c1-7-3-11(19)16-13-9(7)5-10-8(6-18)4-12(20)17(2)14(10)15(13)21/h3-5,18,21H,6H2,1-2H3,(H,16,19) |
| InChIKey | KOLKVNKEAJWZES-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|