C18H13F2N5O3 — CID 44539340
3-[[6-fluoro-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-N-hydroxy-N-methyl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 44539340) has the molecular formula C18H13F2N5O3 and a molecular weight of 385.33 g/mol. Its IUPAC name is 3-[[6-fluoro-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-N-hydroxy-N-methyl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[[6-fluoro-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-N-hydroxy-N-methyl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 44539340 |
| Molecular Formula | C18H13F2N5O3 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 3-[[6-fluoro-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-N-hydroxy-N-methyl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CN(O)C(=O)c1nc(Cc2c(-c3ccc(F)cc3)nc3ccc(F)cn23)no1 |
| InChI | InChI=1S/C18H13F2N5O3/c1-24(27)18(26)17-21-14(23-28-17)8-13-16(10-2-4-11(19)5-3-10)22-15-7-6-12(20)9-25(13)15/h2-7,9,27H,8H2,1H3 |
| InChIKey | YYOMABVKRUMJLU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|