C17H28O9 — CID 44539348
dimethyl (1S,3S,6R,7R)-1-heptyl-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4-dicarboxylate (PubChem CID 44539348) has the molecular formula C17H28O9 and a molecular weight of 376.40 g/mol. Its IUPAC name is dimethyl (1S,3S,6R,7R)-1-heptyl-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4-dicarboxylate.
| Compound Name | dimethyl (1S,3S,6R,7R)-1-heptyl-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 44539348 |
| Molecular Formula | C17H28O9 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | dimethyl (1S,3S,6R,7R)-1-heptyl-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4-dicarboxylate |
| SMILES | CCCCCCC[C@@]12OC([C@H](O)[C@H]1O)C(O)(C(=O)OC)[C@@H](C(=O)OC)O2 |
| InChI | InChI=1S/C17H28O9/c1-4-5-6-7-8-9-16-11(19)10(18)12(25-16)17(22,15(21)24-3)13(26-16)14(20)23-2/h10-13,18-19,22H,4-9H2,1-3H3/t10-,11-,12?,13-,16+,17?/m1/s1 |
| InChIKey | JALHJFSCDVPAKH-KJORZQAMSA-N |
| XLogP | -0.36 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|