About 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine
1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine (PubChem CID 44539383) has the molecular formula C23H22N4
and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine |
| PubChem CID | 44539383 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine |
| SMILES | Nc1nccn2c(C3CCC3)nc(-c3ccc(Cc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C23H22N4/c24-22-21-20(26-23(19-7-4-8-19)27(21)14-13-25-22)18-11-9-17(10-12-18)15-16-5-2-1-3-6-16/h1-3,5-6,9-14,19H,4,7-8,15H2,(H2,24,25) |
| InChIKey | KNIYAXLISPGCDY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine?
The IUPAC name of 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine (CID 44539383) is 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine.
What is the SMILES notation for 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine?
The canonical SMILES for 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine is Nc1nccn2c(C3CCC3)nc(-c3ccc(Cc4ccccc4)cc3)c12.
What is the InChIKey of 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine?
The InChIKey is KNIYAXLISPGCDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4/c24-22-21-20(26-23(19-7-4-8-19)27(21)14-13-25-22)18-11-9-17(10-12-18)15-16-5-2-1-3-6-16/h1-3,5-6,9-14,19H,4,7-8,15H2,(H2,24,25).
What are the key properties of 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine?
1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine has a molecular weight of 354.46 g/mol, XLogP of 4.84, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-benzylphenyl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine is sourced from PubChem (CID 44539383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).