C22H21ClN4O — CID 44539638
6-(1-azabicyclo[2.2.2]octan-3-yl)-2-(4-chlorophenyl)-2,3,6-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-7-one (PubChem CID 44539638) has the molecular formula C22H21ClN4O and a molecular weight of 392.89 g/mol. Its IUPAC name is 6-(1-azabicyclo[2.2.2]octan-3-yl)-2-(4-chlorophenyl)-2,3,6-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-7-one.
| Compound Name | 6-(1-azabicyclo[2.2.2]octan-3-yl)-2-(4-chlorophenyl)-2,3,6-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-7-one |
|---|---|
| PubChem CID | 44539638 |
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 6-(1-azabicyclo[2.2.2]octan-3-yl)-2-(4-chlorophenyl)-2,3,6-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-7-one |
| SMILES | O=C1c2cccc3c2c(nn3-c2ccc(Cl)cc2)CN1C1CN2CCC1CC2 |
| InChI | InChI=1S/C22H21ClN4O/c23-15-4-6-16(7-5-15)27-19-3-1-2-17-21(19)18(24-27)12-26(22(17)28)20-13-25-10-8-14(20)9-11-25/h1-7,14,20H,8-13H2 |
| InChIKey | OGOFEMIUXRBJCL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |