C28H24N6O3 — CID 44540013
1-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)ethane-1,2-dione (PubChem CID 44540013) has the molecular formula C28H24N6O3 and a molecular weight of 492.54 g/mol. Its IUPAC name is 1-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)ethane-1,2-dione.
| Compound Name | 1-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 44540013 |
| Molecular Formula | C28H24N6O3 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 1-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(5-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)ethane-1,2-dione |
| SMILES | COc1cnc(-n2cnc(C)n2)c2[nH]cc(C(=O)C(=O)N3CCc4c(cccc4-c4ccccc4)C3)c12 |
| InChI | InChI=1S/C28H24N6O3/c1-17-31-16-34(32-17)27-25-24(23(37-2)14-30-27)22(13-29-25)26(35)28(36)33-12-11-21-19(15-33)9-6-10-20(21)18-7-4-3-5-8-18/h3-10,13-14,16,29H,11-12,15H2,1-2H3 |
| InChIKey | SMYPJAMVIWPAAU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|