C23H21BrN2O — CID 44540727
6'-(bromomethyl)-1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] (PubChem CID 44540727) has the molecular formula C23H21BrN2O and a molecular weight of 421.34 g/mol. Its IUPAC name is 6'-(bromomethyl)-1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole].
| Compound Name | 6'-(bromomethyl)-1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] |
|---|---|
| PubChem CID | 44540727 |
| Molecular Formula | C23H21BrN2O |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 6'-(bromomethyl)-1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] |
| SMILES | CN1c2cc(CBr)ccc2C(C)(C)C12C=Nc1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C23H21BrN2O/c1-22(2)18-10-8-15(13-24)12-19(18)26(3)23(22)14-25-21-17-7-5-4-6-16(17)9-11-20(21)27-23/h4-12,14H,13H2,1-3H3 |
| InChIKey | HCZAVQLGDOGZQL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|