C16H17N3O6 — CID 44541025
2-N,3-dihydroxy-4-(hydroxymethyl)-5-N-[(4-methoxyphenyl)methyl]pyridine-2,5-dicarboxamide (PubChem CID 44541025) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-N,3-dihydroxy-4-(hydroxymethyl)-5-N-[(4-methoxyphenyl)methyl]pyridine-2,5-dicarboxamide.
| Compound Name | 2-N,3-dihydroxy-4-(hydroxymethyl)-5-N-[(4-methoxyphenyl)methyl]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 44541025 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-N,3-dihydroxy-4-(hydroxymethyl)-5-N-[(4-methoxyphenyl)methyl]pyridine-2,5-dicarboxamide |
| SMILES | COc1ccc(CNC(=O)c2cnc(C(=O)NO)c(O)c2CO)cc1 |
| InChI | InChI=1S/C16H17N3O6/c1-25-10-4-2-9(3-5-10)6-18-15(22)11-7-17-13(16(23)19-24)14(21)12(11)8-20/h2-5,7,20-21,24H,6,8H2,1H3,(H,18,22)(H,19,23) |
| InChIKey | FFZSWIQSHFCKNH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|