About diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate
diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate (PubChem CID 44541125) has the molecular formula C18H21BrO4
and a molecular weight of 381.27 g/mol. Its IUPAC name is diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
| PubChem CID | 44541125 |
| Molecular Formula | C18H21BrO4 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
| SMILES | C=CC1CC(C(=O)OCC)(C(=O)OCC)Cc2ccc(Br)cc21 |
| InChI | InChI=1S/C18H21BrO4/c1-4-12-10-18(16(20)22-5-2,17(21)23-6-3)11-13-7-8-14(19)9-15(12)13/h4,7-9,12H,1,5-6,10-11H2,2-3H3 |
| InChIKey | MPZOZQQZQPFZOM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate?
The IUPAC name of diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate (CID 44541125) is diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate.
What is the SMILES notation for diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate?
The canonical SMILES for diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate is C=CC1CC(C(=O)OCC)(C(=O)OCC)Cc2ccc(Br)cc21.
What is the InChIKey of diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate?
The InChIKey is MPZOZQQZQPFZOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21BrO4/c1-4-12-10-18(16(20)22-5-2,17(21)23-6-3)11-13-7-8-14(19)9-15(12)13/h4,7-9,12H,1,5-6,10-11H2,2-3H3.
What are the key properties of diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate?
diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate has a molecular weight of 381.27 g/mol, XLogP of 3.78, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 6-bromo-4-ethenyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate is sourced from PubChem (CID 44541125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).