C31H32O9S — CID 44541129
[(2S)-3-[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-(2-oxoethyl)oxolan-2-yl]-2-benzoyloxypropyl] benzoate (PubChem CID 44541129) has the molecular formula C31H32O9S and a molecular weight of 580.66 g/mol. Its IUPAC name is [(2S)-3-[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-(2-oxoethyl)oxolan-2-yl]-2-benzoyloxypropyl] benzoate.
| Compound Name | [(2S)-3-[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-(2-oxoethyl)oxolan-2-yl]-2-benzoyloxypropyl] benzoate |
|---|---|
| PubChem CID | 44541129 |
| Molecular Formula | C31H32O9S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | [(2S)-3-[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-(2-oxoethyl)oxolan-2-yl]-2-benzoyloxypropyl] benzoate |
| SMILES | CO[C@@H]1[C@@H](CS(=O)(=O)c2ccccc2)[C@H](CC=O)O[C@@H]1C[C@@H](COC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H32O9S/c1-37-29-26(21-41(35,36)25-15-9-4-10-16-25)27(17-18-32)40-28(29)19-24(39-31(34)23-13-7-3-8-14-23)20-38-30(33)22-11-5-2-6-12-22/h2-16,18,24,26-29H,17,19-21H2,1H3/t24-,26-,27-,28+,29+/m0/s1 |
| InChIKey | JTAKRIVELXVMOX-MQKGOTMSSA-N |
| XLogP | 3.92 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|