About ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate
ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate (PubChem CID 44541147) has the molecular formula C20H38N4O2
and a molecular weight of 366.55 g/mol. Its IUPAC name is ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate |
| PubChem CID | 44541147 |
| Molecular Formula | C20H38N4O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C)(N2CCC(N[C@H]3CCCC[C@@H]3N)CC2)CC1 |
| InChI | InChI=1S/C20H38N4O2/c1-3-26-19(25)23-14-10-20(2,11-15-23)24-12-8-16(9-13-24)22-18-7-5-4-6-17(18)21/h16-18,22H,3-15,21H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | KPVQSGDOQBFPQP-ROUUACIJSA-N |
| XLogP | 2.32 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate?
The IUPAC name of ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate (CID 44541147) is ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate?
The canonical SMILES for ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate is CCOC(=O)N1CCC(C)(N2CCC(N[C@H]3CCCC[C@@H]3N)CC2)CC1.
What is the InChIKey of ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate?
The InChIKey is KPVQSGDOQBFPQP-ROUUACIJSA-N. The full InChI is InChI=1S/C20H38N4O2/c1-3-26-19(25)23-14-10-20(2,11-15-23)24-12-8-16(9-13-24)22-18-7-5-4-6-17(18)21/h16-18,22H,3-15,21H2,1-2H3/t17-,18-/m0/s1.
What are the key properties of ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate?
ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate has a molecular weight of 366.55 g/mol, XLogP of 2.32, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[4-[[(1S,2S)-2-aminocyclohexyl]amino]piperidin-1-yl]-4-methylpiperidine-1-carboxylate is sourced from PubChem (CID 44541147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).