C23H22O7 — CID 44541514
(7S,11R)-7,11-bis(4-hydroxyphenyl)-3,3-dimethyl-2,4-dioxaspiro[5.5]undecane-1,5,9-trione (PubChem CID 44541514) has the molecular formula C23H22O7 and a molecular weight of 410.42 g/mol. Its IUPAC name is (7S,11R)-7,11-bis(4-hydroxyphenyl)-3,3-dimethyl-2,4-dioxaspiro[5.5]undecane-1,5,9-trione.
| Compound Name | (7S,11R)-7,11-bis(4-hydroxyphenyl)-3,3-dimethyl-2,4-dioxaspiro[5.5]undecane-1,5,9-trione |
|---|---|
| PubChem CID | 44541514 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (7S,11R)-7,11-bis(4-hydroxyphenyl)-3,3-dimethyl-2,4-dioxaspiro[5.5]undecane-1,5,9-trione |
| SMILES | CC1(C)OC(=O)C2(C(=O)O1)[C@@H](c1ccc(O)cc1)CC(=O)C[C@H]2c1ccc(O)cc1 |
| InChI | InChI=1S/C23H22O7/c1-22(2)29-20(27)23(21(28)30-22)18(13-3-7-15(24)8-4-13)11-17(26)12-19(23)14-5-9-16(25)10-6-14/h3-10,18-19,24-25H,11-12H2,1-2H3/t18-,19+ |
| InChIKey | INWUMRUEAJNNEV-KDURUIRLSA-N |
| XLogP | 3.15 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|