About 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide
2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide (PubChem CID 44541922) has the molecular formula C17H12N4O2
and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide |
| PubChem CID | 44541922 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2[nH]c(-c3ccc(-c4cnco4)cc3)nc12 |
| InChI | InChI=1S/C17H12N4O2/c18-16(22)12-2-1-3-13-15(12)21-17(20-13)11-6-4-10(5-7-11)14-8-19-9-23-14/h1-9H,(H2,18,22)(H,20,21) |
| InChIKey | FFFUQLICAJOHFJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide?
The IUPAC name of 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide (CID 44541922) is 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide.
What is the SMILES notation for 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide?
The canonical SMILES for 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide is NC(=O)c1cccc2[nH]c(-c3ccc(-c4cnco4)cc3)nc12.
What is the InChIKey of 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide?
The InChIKey is FFFUQLICAJOHFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4O2/c18-16(22)12-2-1-3-13-15(12)21-17(20-13)11-6-4-10(5-7-11)14-8-19-9-23-14/h1-9H,(H2,18,22)(H,20,21).
What are the key properties of 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide?
2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide has a molecular weight of 304.31 g/mol, XLogP of 2.98, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-oxazol-5-yl)phenyl]-1H-benzimidazole-4-carboxamide is sourced from PubChem (CID 44541922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).