About N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide
N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide (PubChem CID 44542054) has the molecular formula C13H11N3O4S
and a molecular weight of 305.32 g/mol. Its IUPAC name is N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide |
| PubChem CID | 44542054 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1nc2cc(OCc3cc(C(=O)NO)no3)ccc2s1 |
| InChI | InChI=1S/C13H11N3O4S/c1-7-14-10-4-8(2-3-12(10)21-7)19-6-9-5-11(16-20-9)13(17)15-18/h2-5,18H,6H2,1H3,(H,15,17) |
| InChIKey | MLOWSHIDXHTBGJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide?
The IUPAC name of N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide (CID 44542054) is N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide is Cc1nc2cc(OCc3cc(C(=O)NO)no3)ccc2s1.
What is the InChIKey of N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide?
The InChIKey is MLOWSHIDXHTBGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O4S/c1-7-14-10-4-8(2-3-12(10)21-7)19-6-9-5-11(16-20-9)13(17)15-18/h2-5,18H,6H2,1H3,(H,15,17).
What are the key properties of N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide?
N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide has a molecular weight of 305.32 g/mol, XLogP of 2.29, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-5-[(2-methyl-1,3-benzothiazol-5-yl)oxymethyl]-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 44542054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).