About 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline
7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline (PubChem CID 44542078) has the molecular formula C20H21FN6
and a molecular weight of 364.43 g/mol. Its IUPAC name is 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline.
Molecular Properties
| Compound Name | 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline |
| PubChem CID | 44542078 |
| Molecular Formula | C20H21FN6 |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline |
| SMILES | Fc1ccc2c(c1)nc(N1CCN(CCn3ccnc3)CC1)c1cccn12 |
| InChI | InChI=1S/C20H21FN6/c21-16-3-4-18-17(14-16)23-20(19-2-1-6-27(18)19)26-12-10-24(11-13-26)8-9-25-7-5-22-15-25/h1-7,14-15H,8-13H2 |
| InChIKey | ASQVLAWCAVGHRV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline?
The IUPAC name of 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline (CID 44542078) is 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline.
What is the SMILES notation for 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline?
The canonical SMILES for 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline is Fc1ccc2c(c1)nc(N1CCN(CCn3ccnc3)CC1)c1cccn12.
What is the InChIKey of 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline?
The InChIKey is ASQVLAWCAVGHRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN6/c21-16-3-4-18-17(14-16)23-20(19-2-1-6-27(18)19)26-12-10-24(11-13-26)8-9-25-7-5-22-15-25/h1-7,14-15H,8-13H2.
What are the key properties of 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline?
7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline has a molecular weight of 364.43 g/mol, XLogP of 2.65, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-[4-(2-imidazol-1-ylethyl)piperazin-1-yl]pyrrolo[1,2-a]quinoxaline is sourced from PubChem (CID 44542078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).