C17H21BrNO4P — CID 44542093
(3S)-3-(4-bromophenyl)-3-diethoxyphosphoryl-1-pyrrol-1-ylpropan-1-one (PubChem CID 44542093) has the molecular formula C17H21BrNO4P and a molecular weight of 414.24 g/mol. Its IUPAC name is (3S)-3-(4-bromophenyl)-3-diethoxyphosphoryl-1-pyrrol-1-ylpropan-1-one.
| Compound Name | (3S)-3-(4-bromophenyl)-3-diethoxyphosphoryl-1-pyrrol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 44542093 |
| Molecular Formula | C17H21BrNO4P |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | (3S)-3-(4-bromophenyl)-3-diethoxyphosphoryl-1-pyrrol-1-ylpropan-1-one |
| SMILES | CCOP(=O)(OCC)[C@@H](CC(=O)n1cccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H21BrNO4P/c1-3-22-24(21,23-4-2)16(14-7-9-15(18)10-8-14)13-17(20)19-11-5-6-12-19/h5-12,16H,3-4,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | OFOGEZNHELRMAL-INIZCTEOSA-N |
| XLogP | 5.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|