About 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride
2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 44542174) has the molecular formula C8H9Cl3N4
and a molecular weight of 267.55 g/mol. Its IUPAC name is 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride |
| PubChem CID | 44542174 |
| Molecular Formula | C8H9Cl3N4 |
| Molecular Weight | 267.55 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N/N=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H8Cl2N4.ClH/c9-6-2-1-5(3-7(6)10)4-13-14-8(11)12;/h1-4H,(H4,11,12,14);1H/b13-4+; |
| InChIKey | XWTMACVBCUKXFY-GAYQJXMFSA-N |
| XLogP | 2.02 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride?
The IUPAC name of 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride (CID 44542174) is 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride.
What is the SMILES notation for 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride?
The canonical SMILES for 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride is Cl.NC(N)=N/N=C/c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride?
The InChIKey is XWTMACVBCUKXFY-GAYQJXMFSA-N. The full InChI is InChI=1S/C8H8Cl2N4.ClH/c9-6-2-1-5(3-7(6)10)4-13-14-8(11)12;/h1-4H,(H4,11,12,14);1H/b13-4+;.
What are the key properties of 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride?
2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride has a molecular weight of 267.55 g/mol, XLogP of 2.02, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride is sourced from PubChem (CID 44542174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).