C25H34O4 — CID 44542224
(2R,4aS,6'R,8aS)-6'-[(1E)-2,6-dimethylhepta-1,6-dienyl]-4-(hydroxymethyl)-7-methyl-4'-methylidenespiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one (PubChem CID 44542224) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is (2R,4aS,6'R,8aS)-6'-[(1E)-2,6-dimethylhepta-1,6-dienyl]-4-(hydroxymethyl)-7-methyl-4'-methylidenespiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one.
| Compound Name | (2R,4aS,6'R,8aS)-6'-[(1E)-2,6-dimethylhepta-1,6-dienyl]-4-(hydroxymethyl)-7-methyl-4'-methylidenespiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one |
|---|---|
| PubChem CID | 44542224 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (2R,4aS,6'R,8aS)-6'-[(1E)-2,6-dimethylhepta-1,6-dienyl]-4-(hydroxymethyl)-7-methyl-4'-methylidenespiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one |
| SMILES | C=C(C)CCC/C(C)=C/[C@H]1CC(=C)C[C@@]2(C=C(CO)[C@@H]3CC(=O)C(C)=C[C@@H]3O2)O1 |
| InChI | InChI=1S/C25H34O4/c1-16(2)7-6-8-17(3)9-21-10-18(4)13-25(28-21)14-20(15-26)22-12-23(27)19(5)11-24(22)29-25/h9,11,14,21-22,24,26H,1,4,6-8,10,12-13,15H2,2-3,5H3/b17-9+/t21-,22-,24-,25+/m0/s1 |
| InChIKey | UIVQQXWRQITZJI-ATUMTDQDSA-N |
| XLogP | 4.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|