C26H40O5SSi — CID 44542413
[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-phenylmethoxypentyl] 4-methylbenzenesulfonate (PubChem CID 44542413) has the molecular formula C26H40O5SSi and a molecular weight of 492.75 g/mol. Its IUPAC name is [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-phenylmethoxypentyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-phenylmethoxypentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 44542413 |
| Molecular Formula | C26H40O5SSi |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-phenylmethoxypentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](C)[C@H](CCOCc2ccccc2)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H40O5SSi/c1-21-13-15-24(16-14-21)32(27,28)30-19-22(2)25(31-33(6,7)26(3,4)5)17-18-29-20-23-11-9-8-10-12-23/h8-16,22,25H,17-20H2,1-7H3/t22-,25-/m0/s1 |
| InChIKey | FQFZZHLBDANLHN-DHLKQENFSA-N |
| XLogP | 6.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|