C20H19BrN8 — CID 44542472
N'-(3-bromophenyl)-N-cyano-5-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,5-diazabicyclo[2.2.1]heptane-2-carboximidamide (PubChem CID 44542472) has the molecular formula C20H19BrN8 and a molecular weight of 451.33 g/mol. Its IUPAC name is N'-(3-bromophenyl)-N-cyano-5-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,5-diazabicyclo[2.2.1]heptane-2-carboximidamide.
| Compound Name | N'-(3-bromophenyl)-N-cyano-5-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,5-diazabicyclo[2.2.1]heptane-2-carboximidamide |
|---|---|
| PubChem CID | 44542472 |
| Molecular Formula | C20H19BrN8 |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | N'-(3-bromophenyl)-N-cyano-5-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,5-diazabicyclo[2.2.1]heptane-2-carboximidamide |
| SMILES | Cc1c[nH]c2ncnc(N3CC4CC3CN4/C(=N/c3cccc(Br)c3)NC#N)c12 |
| InChI | InChI=1S/C20H19BrN8/c1-12-7-23-18-17(12)19(26-11-25-18)28-8-16-6-15(28)9-29(16)20(24-10-22)27-14-4-2-3-13(21)5-14/h2-5,7,11,15-16H,6,8-9H2,1H3,(H,24,27)(H,23,25,26) |
| InChIKey | BLMCSSLGKGQBHN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|