C22H20O9 — CID 44542636
[(3R,3aR,6S,6aR)-3-(3-hydroxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2-acetyloxybenzoate (PubChem CID 44542636) has the molecular formula C22H20O9 and a molecular weight of 428.39 g/mol. Its IUPAC name is [(3R,3aR,6S,6aR)-3-(3-hydroxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2-acetyloxybenzoate.
| Compound Name | [(3R,3aR,6S,6aR)-3-(3-hydroxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2-acetyloxybenzoate |
|---|---|
| PubChem CID | 44542636 |
| Molecular Formula | C22H20O9 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | [(3R,3aR,6S,6aR)-3-(3-hydroxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C22H20O9/c1-12(23)29-16-8-3-2-7-15(16)22(26)31-18-11-28-19-17(10-27-20(18)19)30-21(25)13-5-4-6-14(24)9-13/h2-9,17-20,24H,10-11H2,1H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | SGNUSUBHPHHKGU-IYWMVGAKSA-N |
| XLogP | 1.87 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|