C25H20N4 — CID 44542680
N-benzyl-2-(3-phenyl-2H-pyrazolo[3,4-b]pyridin-5-yl)aniline (PubChem CID 44542680) has the molecular formula C25H20N4 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-benzyl-2-(3-phenyl-2H-pyrazolo[3,4-b]pyridin-5-yl)aniline.
| Compound Name | N-benzyl-2-(3-phenyl-2H-pyrazolo[3,4-b]pyridin-5-yl)aniline |
|---|---|
| PubChem CID | 44542680 |
| Molecular Formula | C25H20N4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-benzyl-2-(3-phenyl-2H-pyrazolo[3,4-b]pyridin-5-yl)aniline |
| SMILES | c1ccc(CNc2ccccc2-c2cnc3n[nH]c(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C25H20N4/c1-3-9-18(10-4-1)16-26-23-14-8-7-13-21(23)20-15-22-24(19-11-5-2-6-12-19)28-29-25(22)27-17-20/h1-15,17,26H,16H2,(H,27,28,29) |
| InChIKey | VNORHOXGOFNORN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |