C22H25NO7S — CID 44542689
(1R,3S,4R,5R,6S)-3-methoxy-6-(4-methylphenyl)sulfonyl-5-(nitromethyl)-4-phenylmethoxy-2-oxabicyclo[4.1.0]heptane (PubChem CID 44542689) has the molecular formula C22H25NO7S and a molecular weight of 447.51 g/mol. Its IUPAC name is (1R,3S,4R,5R,6S)-3-methoxy-6-(4-methylphenyl)sulfonyl-5-(nitromethyl)-4-phenylmethoxy-2-oxabicyclo[4.1.0]heptane.
| Compound Name | (1R,3S,4R,5R,6S)-3-methoxy-6-(4-methylphenyl)sulfonyl-5-(nitromethyl)-4-phenylmethoxy-2-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 44542689 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (1R,3S,4R,5R,6S)-3-methoxy-6-(4-methylphenyl)sulfonyl-5-(nitromethyl)-4-phenylmethoxy-2-oxabicyclo[4.1.0]heptane |
| SMILES | CO[C@H]1O[C@@H]2C[C@]2(S(=O)(=O)c2ccc(C)cc2)[C@H](C[N+](=O)[O-])[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H25NO7S/c1-15-8-10-17(11-9-15)31(26,27)22-12-19(22)30-21(28-2)20(18(22)13-23(24)25)29-14-16-6-4-3-5-7-16/h3-11,18-21H,12-14H2,1-2H3/t18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | JJZWTPYQOMFPEG-YXIAPDDASA-N |
| XLogP | 2.76 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|