About 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide
2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide (PubChem CID 44542743) has the molecular formula C8H7N3O4S
and a molecular weight of 241.23 g/mol. Its IUPAC name is 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide.
Molecular Properties
| Compound Name | 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide |
| PubChem CID | 44542743 |
| Molecular Formula | C8H7N3O4S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide |
| SMILES | NS(=O)(=O)c1c(-c2ccccc2)no[n+]1[O-] |
| InChI | InChI=1S/C8H7N3O4S/c9-16(13,14)8-7(10-15-11(8)12)6-4-2-1-3-5-6/h1-5H,(H2,9,13,14) |
| InChIKey | DSSZDNBKKXDICA-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 113.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide?
The IUPAC name of 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide (CID 44542743) is 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide.
What is the SMILES notation for 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide?
The canonical SMILES for 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide is NS(=O)(=O)c1c(-c2ccccc2)no[n+]1[O-].
What is the InChIKey of 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide?
The InChIKey is DSSZDNBKKXDICA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O4S/c9-16(13,14)8-7(10-15-11(8)12)6-4-2-1-3-5-6/h1-5H,(H2,9,13,14).
What are the key properties of 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide?
2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide has a molecular weight of 241.23 g/mol, XLogP of -0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-sulfonamide is sourced from PubChem (CID 44542743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).