C19H18BrClN8 — CID 44542776
(2S)-N'-(3-bromophenyl)-4-(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-cyano-2-methylpiperazine-1-carboximidamide (PubChem CID 44542776) has the molecular formula C19H18BrClN8 and a molecular weight of 473.77 g/mol. Its IUPAC name is (2S)-N'-(3-bromophenyl)-4-(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-cyano-2-methylpiperazine-1-carboximidamide.
| Compound Name | (2S)-N'-(3-bromophenyl)-4-(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-cyano-2-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 44542776 |
| Molecular Formula | C19H18BrClN8 |
| Molecular Weight | 473.77 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | (2S)-N'-(3-bromophenyl)-4-(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-cyano-2-methylpiperazine-1-carboximidamide |
| SMILES | C[C@H]1CN(c2ncnc3[nH]cc(Cl)c23)CCN1/C(=N/c1cccc(Br)c1)NC#N |
| InChI | InChI=1S/C19H18BrClN8/c1-12-9-28(18-16-15(21)8-23-17(16)25-11-26-18)5-6-29(12)19(24-10-22)27-14-4-2-3-13(20)7-14/h2-4,7-8,11-12H,5-6,9H2,1H3,(H,24,27)(H,23,25,26)/t12-/m0/s1 |
| InChIKey | CZFWUZDEOVCKHA-LBPRGKRZSA-N |
| XLogP | 3.64 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|