About 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol
3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol (PubChem CID 44542800) has the molecular formula C22H16O3S
and a molecular weight of 360.43 g/mol. Its IUPAC name is 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol.
Molecular Properties
| Compound Name | 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol |
| PubChem CID | 44542800 |
| Molecular Formula | C22H16O3S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol |
| SMILES | Oc1cccc(-c2cc(-c3cccc(O)c3)c(-c3cccc(O)c3)s2)c1 |
| InChI | InChI=1S/C22H16O3S/c23-17-7-1-4-14(10-17)20-13-21(15-5-2-8-18(24)11-15)26-22(20)16-6-3-9-19(25)12-16/h1-13,23-25H |
| InChIKey | ZBWIOPSLXQDYEV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol?
The IUPAC name of 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol (CID 44542800) is 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol.
What is the SMILES notation for 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol?
The canonical SMILES for 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol is Oc1cccc(-c2cc(-c3cccc(O)c3)c(-c3cccc(O)c3)s2)c1.
What is the InChIKey of 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol?
The InChIKey is ZBWIOPSLXQDYEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16O3S/c23-17-7-1-4-14(10-17)20-13-21(15-5-2-8-18(24)11-15)26-22(20)16-6-3-9-19(25)12-16/h1-13,23-25H.
What are the key properties of 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol?
3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol has a molecular weight of 360.43 g/mol, XLogP of 5.87, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4,5-bis(3-hydroxyphenyl)thiophen-2-yl]phenol is sourced from PubChem (CID 44542800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).