C20H24BrN7O2S — CID 44542923
(2S)-N-(3-bromophenyl)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N'-methylsulfonylpiperazine-1-carboximidamide (PubChem CID 44542923) has the molecular formula C20H24BrN7O2S and a molecular weight of 506.43 g/mol. Its IUPAC name is (2S)-N-(3-bromophenyl)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N'-methylsulfonylpiperazine-1-carboximidamide.
| Compound Name | (2S)-N-(3-bromophenyl)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N'-methylsulfonylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 44542923 |
| Molecular Formula | C20H24BrN7O2S |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | (2S)-N-(3-bromophenyl)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N'-methylsulfonylpiperazine-1-carboximidamide |
| SMILES | Cc1c[nH]c2ncnc(N3CCN(/C(=N/S(C)(=O)=O)Nc4cccc(Br)c4)[C@@H](C)C3)c12 |
| InChI | InChI=1S/C20H24BrN7O2S/c1-13-10-22-18-17(13)19(24-12-23-18)27-7-8-28(14(2)11-27)20(26-31(3,29)30)25-16-6-4-5-15(21)9-16/h4-6,9-10,12,14H,7-8,11H2,1-3H3,(H,25,26)(H,22,23,24)/t14-/m0/s1 |
| InChIKey | ZZABGZFZUJBLLS-AWEZNQCLSA-N |
| XLogP | 2.97 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|